Ibuprofen
Ibuprofen marupoan ubek nan digunoan untuak mangurangi raso ngilo jo paradangan, misalnyo sakik gigi, kram kutiko datang bulan, jo radang sandi.
Ubek ko tasadio dalam bantuak tablet 400 mg, sirup, jo suntikan.
-Ibuprofen_Structural_Formula_V1.svg) | |
 | |
| Data klinis | |
|---|---|
| Palafalan | /ˈaɪbjuːproʊfɛn/, /aɪbjuːˈproʊfən/, |
| Namo dagang | Advil, Motrin, Nurofen, others |
| Namo lain | isobutylphenylpropionic acid |
| AHFS/Drugs.com | Monograph |
| MedlinePlus | a682159 |
| Lisensi data | |
| Kategori pado kahamilan |
|
| Rute masuak ubek | by mouth, rectal, topical, and intravenous |
| Kode ATC | |
| Status legal | |
| Status legal |
|
| Farmakokinetik data | |
| Bioavailabilitas | 80–100% (by mouth), 87% (rectal) |
| Ikatan protein | 98% |
| Metabolisme | Liver (CYP2C9) |
| Metabolite | ibuprofen glucuronide, 2-hydroxyibuprofen, 3-hydroxyibuprofen, carboxy-ibuprofen, 1-hydroxyibuprofen |
| Awitan aksi | 30 min |
| Eliminasi wakatu paruah | 2–4 h |
| Ekskresi | Urine (95%) |
| Pangenal | |
Namo IUPAC (RS)-2-(4-(2-Methylpropyl)phenyl)propanoic acid | |
| Nomor CAS | |
| PubChem CID | |
| IUPHAR/BPS | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEBI | |
| ChEMBL | |
| PDB ligand | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.036.152  |
| Data kimia jo fisika | |
| Formula | C13H18O2 |
| Molar mass | 206.29 g/mol g·mol−1 |
| 3D model (JSmol) | |
| Chirality | Racemic mixture |
| Density | 1.03 g/ml g/cm3 |
| Melting point | 75 to 78 °C (167 to 172 °F) |
| Boiling point | 157 °C (315 °F) at 4 mmHg |
| Solubility in water | 0.021 mg/mL (20 °C) |
SMILES CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O | |
InChI InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)  Key:HEFNNWSXXWATRW-UHFFFAOYSA-N | |
| (verify) | |
Rujuakan
This article uses material from the Wikipedia Minangkabau article Ibuprofen, which is released under the Creative Commons Attribution-ShareAlike 3.0 license ("CC BY-SA 3.0"); additional terms may apply (view authors). Konten tasadio di bawah CC BY-SA 4.0 kacuali dinyatoan lain. Images, videos and audio are available under their respective licenses.
®Wikipedia is a registered trademark of the Wiki Foundation, Inc. Wiki Minangkabau (DUHOCTRUNGQUOC.VN) is an independent company and has no affiliation with Wiki Foundation.